CAS 1220028-61-4: 3-[2-Nitro-4-(trifluoromethyl)phenoxy]azetidine

Description: 3-[2-Nitro-4-(trifluoromethyl)phenoxy]azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a phenoxy group, where a nitro group and a trifluoromethyl group are substituted on the aromatic ring, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity, while the trifluoromethyl group can influence its lipophilicity and electronic characteristics. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of multiple functional groups may allow for further chemical modifications, expanding its utility in various chemical syntheses. As with many compounds containing halogens and nitro groups, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₁₀H₉F₃N₂O₃

InChI: InChI=1S/C10H9F3N2O3/c11-10(12,13)6-1-2-9(8(3-6)15(16)17)18-7-4-14-5-7/h1-3,7,14H,4-5H2

InChI key: InChIKey=AQKLDHYNULJRLA-UHFFFAOYSA-N

SMILES: O=N(=O)C1=CC(=CC=C1OC2CNC2)C(F)(F)F

Synonyms:

• 3-[2-Nitro-4-(trifluoromethyl)phenoxy]azetidine
• Azetidine, 3-[2-nitro-4-(trifluoromethyl)phenoxy]-

3-(2-Nitro-4-(trifluoromethyl)phenoxy)azetidine

CAS: 1220028-61-4

• Purity: 95+%
• Molecular weight: 262.18798828125

3-[2-Nitro-4-(trifluoromethyl)phenoxy]azetidine

CAS: 1220028-61-4

Versatile small molecule scaffold

• Formula: C₁₀H₉F₃N₂O₃
• Purity: Min. 95%
• Molecular weight: 262.18 g/mol