CAS 1220028-63-6

Pyrrolidine, 3-[[2-(trifluoromethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[[2-(trifluoromethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a trifluoromethyl group attached to a phenoxy moiety contributes to its unique properties, including increased lipophilicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The trifluoromethyl group can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological activities, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which it is studied. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₁₂H₁₅ClF₃NO

InChI: InChI=1S/C12H14F3NO.ClH/c13-12(14,15)10-3-1-2-4-11(10)17-8-9-5-6-16-7-9;/h1-4,9,16H,5-8H2;1H

InChI key: InChIKey=LJSDALTXFVLUPI-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(OCC2CCNC2)C=CC=C1.Cl

Synonyms:

• Pyrrolidine, 3-[[2-(trifluoromethyl)phenoxy]methyl]-, hydrochloride (1:1)
• 3-{[2-(Trifluoromethyl)phenoxy]methyl}pyrrolidinehydrochloride