CAS 1220028-69-2

3-(2-Propylphenoxy)azetidine

Description:

3-(2-Propylphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a propylphenoxy substituent, indicating that a propyl group is attached to a phenyl ring, which in turn is connected to the azetidine nitrogen. This structure contributes to its unique chemical properties, including potential lipophilicity due to the aromatic component and the presence of the nitrogen atom, which may participate in hydrogen bonding. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be influenced by the steric and electronic effects of the substituents. Additionally, the presence of the azetidine ring may impart specific reactivity patterns, such as nucleophilic behavior, which can be exploited in synthetic applications. As with many organic compounds, the stability, solubility, and reactivity of 3-(2-Propylphenoxy)azetidine can vary based on environmental conditions and the presence of other functional groups.

Formula: C₁₂H₁₇NO

InChI: InChI=1S/C12H17NO/c1-2-5-10-6-3-4-7-12(10)14-11-8-13-9-11/h3-4,6-7,11,13H,2,5,8-9H2,1H3

InChI key: InChIKey=CKWYKENQLSGBIN-UHFFFAOYSA-N

SMILES: O(C1=C(CCC)C=CC=C1)C2CNC2

Synonyms:

• 3-(2-Propylphenoxy)azetidine
• Azetidine, 3-(2-propylphenoxy)-