CymitQuimica logo

CAS 1220028-77-2

:

Piperidine, 2-methyl-1-(2-piperidinylmethyl)-, hydrochloride (1:2)

Description:
Piperidine, 2-methyl-1-(2-piperidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine backbone, which is a six-membered saturated nitrogen-containing ring. This substance features a methyl group and an additional piperidinylmethyl substituent, contributing to its structural complexity and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceuticals and organic synthesis. The presence of the piperidine moiety suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Its properties, such as melting point, solubility, and stability, can vary based on the specific conditions and purity of the compound. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C12H24N2·2ClH
InChI:InChI=1S/C12H24N2.2ClH/c1-11-6-3-5-9-14(11)10-12-7-2-4-8-13-12;;/h11-13H,2-10H2,1H3;2*1H
InChI key:InChIKey=RDNDBNLRLKSETC-UHFFFAOYSA-N
SMILES:C(N1C(C)CCCC1)C2CCCCN2.Cl
Synonyms:
  • Piperidine, 2-methyl-1-(2-piperidinylmethyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.