
CAS 1220028-80-7
:Propanamide, 3-amino-N-(2-hydroxy-1,1-dimethylethyl)-, hydrochloride (1:1)
Description:
Propanamide, 3-amino-N-(2-hydroxy-1,1-dimethylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of the amino group suggests that it can act as a base, while the hydroxyl group contributes to its solubility in water and may enhance its reactivity. The hydrochloride form indicates that the compound is a salt, which typically improves stability and solubility in aqueous solutions. This compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or active ingredient, given its structural features that suggest interactions with biological systems. Its molecular structure likely allows for various conformations, influencing its physical properties such as melting point and solubility. As with many amides, it may also display moderate to low volatility. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory or industrial settings.
Formula:C7H16N2O2·ClH
InChI:InChI=1S/C7H16N2O2.ClH/c1-7(2,5-10)9-6(11)3-4-8;/h10H,3-5,8H2,1-2H3,(H,9,11);1H
InChI key:InChIKey=OVZKDIMNGLZRCE-UHFFFAOYSA-N
SMILES:C(NC(CCN)=O)(CO)(C)C.Cl
Synonyms:- Propanamide, 3-amino-N-(2-hydroxy-1,1-dimethylethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.