
CAS 1220028-81-8
:Pyrrolidine, 3-[[2-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[[2-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The compound features a phenoxy group substituted with an isopropyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the isopropyl group may influence its lipophilicity and biological activity. This compound may exhibit specific pharmacological effects, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the functional groups present, and it may undergo typical reactions associated with amines and ethers. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in research or industry.
Formula:C14H21NO·ClH
InChI:InChI=1S/C14H21NO.ClH/c1-11(2)13-5-3-4-6-14(13)16-10-12-7-8-15-9-12;/h3-6,11-12,15H,7-10H2,1-2H3;1H
InChI key:InChIKey=SNRBCKJVPJNKMN-UHFFFAOYSA-N
SMILES:O(CC1CCNC1)C2=C(C(C)C)C=CC=C2.Cl
Synonyms:- Pyrrolidine, 3-[[2-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.