CAS 1220028-85-2

Piperidine, 3-methyl-1-(2-piperidinylmethyl)-, hydrochloride (1:2)

Description:

Piperidine, 3-methyl-1-(2-piperidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine backbone, which is a six-membered saturated heterocyclic amine. This compound features a methyl group at the 3-position and a piperidinylmethyl substituent at the 1-position, contributing to its structural complexity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various chemical applications. The presence of multiple piperidine rings suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The compound's molecular interactions may involve hydrogen bonding and other non-covalent interactions due to the amine functionalities. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices. Overall, this compound's unique structure and properties make it of interest in both synthetic chemistry and medicinal research.

Formula: C₁₂H₂₄N₂·2ClH

InChI: InChI=1S/C12H24N2.2ClH/c1-11-5-4-8-14(9-11)10-12-6-2-3-7-13-12;;/h11-13H,2-10H2,1H3;2*1H

InChI key: InChIKey=ZSWXEYXMUVJNKU-UHFFFAOYSA-N

SMILES: C(N1CC(C)CCC1)C2CCCCN2.Cl

Synonyms:

• Piperidine, 3-methyl-1-(2-piperidinylmethyl)-, hydrochloride (1:2)