CAS 1220028-88-5

5-Bromo-N-(3-methoxypropyl)-4-methyl-2-pyridinamine

Description:

5-Bromo-N-(3-methoxypropyl)-4-methyl-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methoxypropyl group at the nitrogen atom contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the methoxy group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The methyl group at the 4-position may influence its steric hindrance and reactivity. As a pyridinamine, it may participate in various chemical reactions typical of amines, such as nucleophilic substitutions and coupling reactions. The compound's structure suggests potential applications in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of pharmaceuticals. However, specific biological activities or toxicity profiles would require further investigation through experimental studies. Overall, its unique functional groups and structural features make it a compound of interest in organic synthesis and drug development.

Formula: C₁₀H₁₅BrN₂O

InChI: InChI=1S/C10H15BrN2O/c1-8-6-10(13-7-9(8)11)12-4-3-5-14-2/h6-7H,3-5H2,1-2H3,(H,12,13)

InChI key: InChIKey=DZEQUXXVJDDEDP-UHFFFAOYSA-N

SMILES: N(CCCOC)C1=CC(C)=C(Br)C=N1

Synonyms:

• 2-Pyridinamine, 5-bromo-N-(3-methoxypropyl)-4-methyl-
• 5-Bromo-N-(3-methoxypropyl)-4-methyl-2-pyridinamine