CAS 1220028-92-1
:1-(5-Bromo-4-methyl-2-pyridinyl)-3-pyrrolidinol
Description:
1-(5-Bromo-4-methyl-2-pyridinyl)-3-pyrrolidinol, identified by its CAS number 1220028-92-1, is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a bromine atom and a methyl group, as well as a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and amines, such as moderate solubility in polar solvents due to the presence of the hydroxyl group. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and pharmacology. The bromine substitution can influence its reactivity and interaction with biological targets, while the pyrrolidinol component may contribute to its pharmacokinetic properties. As with many organic compounds, the specific characteristics, including melting point, boiling point, and spectral properties, would depend on the purity and specific conditions under which the compound is analyzed. Overall, this compound represents a class of substances that may have applications in drug development or as intermediates in organic synthesis.
Formula:C10H13BrN2O
InChI:InChI=1S/C10H13BrN2O/c1-7-4-10(12-5-9(7)11)13-3-2-8(14)6-13/h4-5,8,14H,2-3,6H2,1H3
InChI key:InChIKey=ZWGOQMNMSQZZBQ-UHFFFAOYSA-N
SMILES:CC=1C=C(N=CC1Br)N2CC(O)CC2
Synonyms:- 1-(5-Bromo-4-methyl-2-pyridinyl)-3-pyrrolidinol
- 3-Pyrrolidinol, 1-(5-bromo-4-methyl-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.