CAS 1220028-95-4

Pyrrolidine, 3-[(2,3,5-trimethylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(2,3,5-trimethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 2,3,5-trimethylphenoxy group indicates that the compound has a phenolic moiety with three methyl substituents, contributing to its hydrophobic characteristics and potentially influencing its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The compound may exhibit properties such as basicity due to the nitrogen atom in the pyrrolidine ring, and it may participate in various chemical reactions typical of amines, including alkylation and acylation. Its specific applications and biological activities would depend on its interaction with biological systems, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₁₄H₂₁NO·ClH

InChI: InChI=1S/C14H21NO.ClH/c1-10-6-11(2)12(3)14(7-10)16-9-13-4-5-15-8-13;/h6-7,13,15H,4-5,8-9H2,1-3H3;1H

InChI key: InChIKey=FNAOVPVSPCJJBF-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=C(C)C(C)=CC(C)=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(2,3,5-trimethylphenoxy)methyl]-, hydrochloride (1:1)