CAS 1220028-97-6

5-Bromo-4-methyl-2-(2-methyl-1-piperidinyl)pyridine

Description:

5-Bromo-4-methyl-2-(2-methyl-1-piperidinyl)pyridine is a chemical compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with a bromine atom and a methyl group. The presence of the piperidine moiety introduces a nitrogen-containing cyclic structure, contributing to its potential biological activity. This compound is typically classified as an organic compound and may exhibit properties such as solubility in organic solvents, depending on the specific functional groups and their interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the bromine and piperidine groups, which can influence the compound's reactivity and binding affinity to biological targets. Additionally, the compound's characteristics, such as melting point, boiling point, and stability, would be influenced by its molecular interactions and the presence of substituents. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₂H₁₇BrN₂

InChI: InChI=1S/C12H17BrN2/c1-9-7-12(14-8-11(9)13)15-6-4-3-5-10(15)2/h7-8,10H,3-6H2,1-2H3

InChI key: InChIKey=NNGIOLBJJIXEEJ-UHFFFAOYSA-N

SMILES: CC1N(CCCC1)C2=CC(C)=C(Br)C=N2

Synonyms:

• 5-Bromo-4-methyl-2-(2-methyl-1-piperidinyl)pyridine
• Pyridine, 5-bromo-4-methyl-2-(2-methyl-1-piperidinyl)-