CAS 1220028-98-7

Piperidine, 4-[2-[(1,6-dibromo-2-naphthalenyl)oxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-[(1,6-dibromo-2-naphthalenyl)oxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The presence of the 1,6-dibromo-2-naphthalenyl group indicates that it has significant aromatic characteristics, contributing to its potential biological activity. The compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacokinetic properties. The structure suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a ligand or a precursor in the synthesis of more complex molecules. Its specific interactions and applications would depend on the functional groups and the overall molecular architecture, which can affect its reactivity and biological interactions. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact are important, particularly due to the presence of bromine atoms.

Formula: C₁₇H₁₉Br₂NO·ClH

InChI: InChI=1S/C17H19Br2NO.ClH/c18-14-2-3-15-13(11-14)1-4-16(17(15)19)21-10-7-12-5-8-20-9-6-12;/h1-4,11-12,20H,5-10H2;1H

InChI key: InChIKey=DMXDCISMYUEUQN-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C=CC1OCCC3CCNCC3)C=C(Br)C=C2.Cl

Synonyms:

• Piperidine, 4-[2-[(1,6-dibromo-2-naphthalenyl)oxy]ethyl]-, hydrochloride (1:1)