CAS 1220029-03-7
:5-(2-Ethyl-1-piperidinyl)-2-(ethylsulfonyl)benzenamine
Description:
5-(2-Ethyl-1-piperidinyl)-2-(ethylsulfonyl)benzenamine is a chemical compound characterized by its complex structure, which includes a piperidine ring and an ethylsulfonyl group attached to a benzene ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the ethylsulfonyl group may enhance its stability and solubility in polar solvents. Additionally, the piperidine moiety can contribute to its pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Its unique combination of functional groups may also impart specific biological activities, which would require further investigation through experimental studies to elucidate its full potential and mechanism of action. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C15H24N2O2S
InChI:InChI=1S/C15H24N2O2S/c1-3-12-7-5-6-10-17(12)13-8-9-15(14(16)11-13)20(18,19)4-2/h8-9,11-12H,3-7,10,16H2,1-2H3
InChI key:InChIKey=GDQJJFXJUZSVFC-UHFFFAOYSA-N
SMILES:C(C)C1N(C2=CC(N)=C(S(CC)(=O)=O)C=C2)CCCC1
Synonyms:- Benzenamine, 5-(2-ethyl-1-piperidinyl)-2-(ethylsulfonyl)-
- 5-(2-Ethyl-1-piperidinyl)-2-(ethylsulfonyl)benzenamine
- 5-(2-Ethyl-1-piperidinyl)-2-(ethylsulfonyl)-phenylamine
- 5-(2-ETHYLPIPERIDIN-1-YL)-2-(ETHYLSULFONYL)ANILINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.