CAS 1220029-11-7

5-Bromo-N-cyclohexyl-N,4-dimethyl-2-pyridinamine

Description:

5-Bromo-N-cyclohexyl-N,4-dimethyl-2-pyridinamine is an organic compound characterized by its unique structure, which includes a bromine atom, a cyclohexyl group, and a dimethyl-substituted pyridine ring. This compound features a pyridinamine core, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the bromine atom may enhance its reactivity and influence its interaction with biological targets. The cyclohexyl group provides steric bulk, which can affect the compound's solubility and binding properties. Additionally, the dimethyl substitution at the 4-position of the pyridine ring can impact the electronic properties and overall stability of the molecule. This compound may exhibit various pharmacological activities, making it of interest in drug discovery and development. Its specific applications and behavior in biological systems would depend on further studies, including its synthesis, characterization, and evaluation of its biological activity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₉BrN₂

InChI: InChI=1S/C13H19BrN2/c1-10-8-13(15-9-12(10)14)16(2)11-6-4-3-5-7-11/h8-9,11H,3-7H2,1-2H3

InChI key: InChIKey=DDOBHZXLFSSTQT-UHFFFAOYSA-N

SMILES: N(C)(C1=CC(C)=C(Br)C=N1)C2CCCCC2

Synonyms:

• 5-Bromo-N-cyclohexyl-N,4-dimethyl-2-pyridinamine
• 2-Pyridinamine, 5-bromo-N-cyclohexyl-N,4-dimethyl-