CAS 1220029-12-8

Piperidine, 3-[2-[(3-bromo[1,1′-biphenyl]-4-yl)oxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-[(3-bromo[1,1′-biphenyl]-4-yl)oxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a bromo-substituted biphenyl moiety indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound exists as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacokinetic properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the biphenyl structure, which can facilitate membrane permeability. The specific functional groups present in the molecule suggest potential interactions with biological targets, making it of interest in drug discovery. Additionally, the presence of the bromine atom may impart unique reactivity and biological activity. Overall, this compound's structural features suggest it could be a candidate for further investigation in various chemical and biological applications.

Formula: C₁₉H₂₂BrNO·ClH

InChI: InChI=1S/C19H22BrNO.ClH/c20-18-13-17(16-6-2-1-3-7-16)8-9-19(18)22-12-10-15-5-4-11-21-14-15;/h1-3,6-9,13,15,21H,4-5,10-12,14H2;1H

InChI key: InChIKey=GGDPYBDASHZJGM-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=CC1OCCC2CCCNC2)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 3-[2-[(3-bromo[1,1′-biphenyl]-4-yl)oxy]ethyl]-, hydrochloride (1:1)