
CAS 1220029-19-5
:Piperidine, 3-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a phenoxy group substituted with a bulky tert-butyl group, contributing to its hydrophobic properties. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity due to its structural features, which can influence interactions with biological targets. Its molecular structure suggests potential uses in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of more complex molecules. As with many piperidine derivatives, it may also possess properties such as analgesic or psychoactive effects, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C21H35NO·ClH
InChI:InChI=1S/C21H35NO.ClH/c1-20(2,3)16-21(4,5)18-8-10-19(11-9-18)23-14-12-17-7-6-13-22-15-17;/h8-11,17,22H,6-7,12-16H2,1-5H3;1H
InChI key:InChIKey=FPYUTZWBNGDWMN-UHFFFAOYSA-N
SMILES:C(CC(C)(C)C)(C)(C)C1=CC=C(OCCC2CCCNC2)C=C1.Cl
Synonyms:- Piperidine, 3-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.