CAS 1220029-21-9

3-Chloro-N,N-diethyl-5-(trifluoromethyl)-2-pyridinamine

Description:

3-Chloro-N,N-diethyl-5-(trifluoromethyl)-2-pyridinamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 3-position and a trifluoromethyl group at the 5-position contributes to its unique reactivity and properties. The diethyl substituents at the nitrogen atom enhance its lipophilicity, potentially affecting its solubility and biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for various applications in medicinal chemistry. Its trifluoromethyl group is known to influence the electronic properties of the molecule, often enhancing metabolic stability and bioactivity. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other interactions, which can be crucial for its function in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing halogens and amines.

Formula: C₁₀H₁₂ClF₃N₂

InChI: InChI=1S/C10H12ClF3N2/c1-3-16(4-2)9-8(11)5-7(6-15-9)10(12,13)14/h5-6H,3-4H2,1-2H3

InChI key: InChIKey=GWDIOLFKLMFJFP-UHFFFAOYSA-N

SMILES: N(CC)(CC)C1=C(Cl)C=C(C(F)(F)F)C=N1

Synonyms:

• 3-Chloro-N,N-diethyl-5-(trifluoromethyl)-2-pyridinamine
• 2-Pyridinamine, 3-chloro-N,N-diethyl-5-(trifluoromethyl)-