
CAS 1220029-44-6
:Piperidine, 4-[2-[(4-chloro-1-naphthalenyl)oxy]ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[2-[(4-chloro-1-naphthalenyl)oxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a 4-substituted piperidine with a side chain that includes a chloro-substituted naphthalene moiety, indicating potential biological activity due to the aromatic system. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the chloro group suggests that it may exhibit specific reactivity or biological interactions, potentially influencing its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure implies potential interactions with biological targets, making it a candidate for further research in drug discovery and development. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C17H20ClNO·ClH
InChI:InChI=1S/C17H20ClNO.ClH/c18-16-5-6-17(15-4-2-1-3-14(15)16)20-12-9-13-7-10-19-11-8-13;/h1-6,13,19H,7-12H2;1H
InChI key:InChIKey=RASVFLDCSQNXQX-UHFFFAOYSA-N
SMILES:O(CCC1CCNCC1)C=2C3=C(C(Cl)=CC2)C=CC=C3.Cl
Synonyms:- Piperidine, 4-[2-[(4-chloro-1-naphthalenyl)oxy]ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.