
CAS 1220029-47-9
:4-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-2-piperazinone
Description:
4-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-2-piperazinone is a chemical compound characterized by its triazine and piperazine moieties. The presence of the triazine ring, which contains chlorine and amino functional groups, contributes to its potential biological activity, particularly in pharmaceutical applications. The piperazinone structure enhances its solubility and reactivity, making it suitable for various chemical reactions. This compound may exhibit properties such as antimicrobial or antitumor activity, which are common in triazine derivatives. Its molecular structure suggests it could interact with biological targets, potentially influencing enzyme activity or receptor binding. Additionally, the chlorine substituent may affect its lipophilicity and overall pharmacokinetic profile. As with many synthetic compounds, safety and toxicity assessments are crucial for determining its suitability for use in medicinal chemistry or other applications. Overall, 4-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-2-piperazinone represents a class of compounds with diverse potential uses in research and industry.
Formula:C7H9ClN6O
InChI:InChI=1S/C7H9ClN6O/c8-5-11-6(9)13-7(12-5)14-2-1-10-4(15)3-14/h1-3H2,(H,10,15)(H2,9,11,12,13)
InChI key:InChIKey=XEVKEQDVMRJDQG-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC(N)=N1)N2CC(=O)NCC2
Synonyms:- 4-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-2-piperazinone
- 2-Piperazinone, 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.