CAS 1220029-52-6

Quinoline, 8-[2-(3-piperidinyl)ethoxy]-, hydrochloride (1:1)

Description:

Quinoline, 8-[2-(3-piperidinyl)ethoxy]-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic structure known for its heterocyclic properties. The presence of the piperidine moiety introduces a nitrogen atom, contributing to the compound's basicity and potential for forming hydrogen bonds. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in aqueous solutions, making it suitable for various biological and chemical applications. Quinoline derivatives are often studied for their pharmacological properties, including antimicrobial and antitumor activities. The specific substitution at the 8-position of the quinoline ring with a 2-(3-piperidinyl)ethoxy group suggests potential interactions with biological targets, possibly influencing its efficacy and selectivity. As with many quinoline derivatives, the compound may exhibit fluorescence, which can be useful in analytical applications. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₁₆H₂₀N₂O·ClH

InChI: InChI=1S/C16H20N2O.ClH/c1-5-14-6-3-10-18-16(14)15(7-1)19-11-8-13-4-2-9-17-12-13;/h1,3,5-7,10,13,17H,2,4,8-9,11-12H2;1H

InChI key: InChIKey=BGCJZUWWEGTMNE-UHFFFAOYSA-N

SMILES: O(CCC1CCCNC1)C=2C3=C(C=CC2)C=CC=N3.Cl

Synonyms:

• Quinoline, 8-[2-(3-piperidinyl)ethoxy]-, hydrochloride (1:1)