CAS 1220029-57-1

Piperidine, 4-[(4-nitrophenoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[(4-nitrophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 4-nitrophenoxy methyl substituent, indicating the presence of a nitrophenyl group attached via an ether linkage to the piperidine ring. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its properties, such as melting point, solubility, and stability, can vary based on the specific conditions and purity of the sample. Additionally, the presence of the nitro group suggests potential reactivity and interactions with biological systems, which could be explored for therapeutic applications. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₁₂H₁₆N₂O₃·ClH

InChI: InChI=1S/C12H16N2O3.ClH/c15-14(16)11-1-3-12(4-2-11)17-9-10-5-7-13-8-6-10;/h1-4,10,13H,5-9H2;1H

InChI key: InChIKey=DNIMXEZKBHFYDH-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C2=CC=C(N(=O)=O)C=C2.Cl

Synonyms:

• Piperidine, 4-[(4-nitrophenoxy)methyl]-, hydrochloride (1:1)