CAS 1220029-60-6

1-(5-Bromo-3-methyl-2-pyridinyl)-4-piperidinol

Description:

1-(5-Bromo-3-methyl-2-pyridinyl)-4-piperidinol is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a methyl group, as well as a piperidinol moiety. The presence of the bromine atom contributes to its reactivity and potential biological activity, while the piperidinol part may influence its solubility and interaction with biological targets. This compound is typically classified as an organic heterocyclic compound due to the presence of nitrogen in both the pyridine and piperidine rings. It may exhibit properties such as being a potential pharmacophore in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.

Formula: C₁₁H₁₅BrN₂O

InChI: InChI=1S/C11H15BrN2O/c1-8-6-9(12)7-13-11(8)14-4-2-10(15)3-5-14/h6-7,10,15H,2-5H2,1H3

InChI key: InChIKey=LOYQEWLZNBJQTG-UHFFFAOYSA-N

SMILES: CC1=C(N2CCC(O)CC2)N=CC(Br)=C1

Synonyms:

• 4-Piperidinol, 1-(5-bromo-3-methyl-2-pyridinyl)-
• 1-(5-Bromo-3-methyl-2-pyridinyl)-4-piperidinol