
CAS 1220029-63-9
:2-[[(Tetrahydro-2H-pyran-4-yl)methyl]amino]-3-pyridinecarboxylic acid
Description:
2-[[(Tetrahydro-2H-pyran-4-yl)methyl]amino]-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a tetrahydro-pyran moiety. This compound features an amino group that is linked to a tetrahydro-2H-pyran, contributing to its potential biological activity. The presence of the carboxylic acid functional group suggests that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific stereochemistry and functional groups may also play a crucial role in determining its pharmacological properties. As with many organic compounds, the stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound represents a class of molecules that may have applications in drug development or as intermediates in synthetic chemistry.
Formula:C12H16N2O3
InChI:InChI=1S/C12H16N2O3/c15-12(16)10-2-1-5-13-11(10)14-8-9-3-6-17-7-4-9/h1-2,5,9H,3-4,6-8H2,(H,13,14)(H,15,16)
InChI key:InChIKey=FUVDHRPNJBQOMF-UHFFFAOYSA-N
SMILES:N(CC1CCOCC1)C2=C(C(O)=O)C=CC=N2
Synonyms:- 3-Pyridinecarboxylic acid, 2-[[(tetrahydro-2H-pyran-4-yl)methyl]amino]-
- 2-[[(Tetrahydro-2H-pyran-4-yl)methyl]amino]-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.