CAS 1220029-66-2

Pyrrolidine, 3-[[2-chloro-4-(1-methyl-1-phenylethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[[2-chloro-4-(1-methyl-1-phenylethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a chloro-substituted phenyl group and a phenoxy group contributes to its unique properties, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. Safety and handling precautions are essential due to the presence of chlorine, which can impart toxicity. As with many chemical substances, thorough characterization through methods such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity in research and development contexts.

Formula: C₂₀H₂₄ClNO·ClH

InChI: InChI=1S/C20H24ClNO.ClH/c1-20(2,16-6-4-3-5-7-16)17-8-9-19(18(21)12-17)23-14-15-10-11-22-13-15;/h3-9,12,15,22H,10-11,13-14H2,1-2H3;1H

InChI key: InChIKey=AAOKVKYCKNEPFK-UHFFFAOYSA-N

SMILES: C(C)(C)(C1=CC(Cl)=C(OCC2CCNC2)C=C1)C3=CC=CC=C3.Cl

Synonyms:

• Pyrrolidine, 3-[[2-chloro-4-(1-methyl-1-phenylethyl)phenoxy]methyl]-, hydrochloride (1:1)