CAS 1220029-67-3

5-Bromo-N-cyclohexyl-N-ethyl-3-methyl-2-pyridinamine

Description:

5-Bromo-N-cyclohexyl-N-ethyl-3-methyl-2-pyridinamine is an organic compound characterized by its complex structure, which includes a bromine atom, a cyclohexyl group, and an ethyl group attached to a pyridine ring. The presence of the bromine substituent indicates potential reactivity, particularly in nucleophilic substitution reactions. The cyclohexyl and ethyl groups contribute to the compound's hydrophobic characteristics, influencing its solubility in organic solvents rather than water. The methyl group on the pyridine ring can affect the electronic properties of the molecule, potentially enhancing its reactivity or stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests it could interact with various biological targets, although specific biological data would be necessary to ascertain its pharmacological properties. Overall, the compound's unique combination of functional groups and structural features makes it a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₁₄H₂₁BrN₂

InChI: InChI=1S/C14H21BrN2/c1-3-17(13-7-5-4-6-8-13)14-11(2)9-12(15)10-16-14/h9-10,13H,3-8H2,1-2H3

InChI key: InChIKey=GSTRNRCUHKNWLY-UHFFFAOYSA-N

SMILES: N(CC)(C1=C(C)C=C(Br)C=N1)C2CCCCC2

Synonyms:

• 5-Bromo-N-cyclohexyl-N-ethyl-3-methyl-2-pyridinamine
• 2-Pyridinamine, 5-bromo-N-cyclohexyl-N-ethyl-3-methyl-