
CAS 1220029-80-0
:Benzenamine, N,N-diethyl-3-(3-pyrrolidinylmethoxy)-, hydrochloride (1:1)
Description:
Benzenamine, N,N-diethyl-3-(3-pyrrolidinylmethoxy)-, hydrochloride (1:1), with the CAS number 1220029-80-0, is a chemical compound characterized by its amine functional group and a pyrrolidine moiety. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The compound features a diethylamino group, which contributes to its basicity and potential biological activity. Its structure suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system, given the presence of the pyrrolidine ring, which is often associated with psychoactive properties. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. Safety data should be consulted for handling and potential toxicity, as with any chemical substance, especially those with biological activity.
Formula:C15H24N2O·ClH
InChI:InChI=1S/C15H24N2O.ClH/c1-3-17(4-2)14-6-5-7-15(10-14)18-12-13-8-9-16-11-13;/h5-7,10,13,16H,3-4,8-9,11-12H2,1-2H3;1H
InChI key:InChIKey=BBHLOYKJEINZSB-UHFFFAOYSA-N
SMILES:N(CC)(CC)C1=CC(OCC2CCNC2)=CC=C1.Cl
Synonyms:- Benzenamine, N,N-diethyl-3-(3-pyrrolidinylmethoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.