CAS 1220029-86-6

6-Chloro-N-(1-methylpropyl)-2-pyridinamine

Description:

6-Chloro-N-(1-methylpropyl)-2-pyridinamine, with the CAS number 1220029-86-6, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chlorine atom at the 6-position of the pyridine ring and a 1-methylpropyl group attached to the nitrogen atom contributes to its unique properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and nitrogen atoms, influencing its solubility in various solvents. It may participate in hydrogen bonding due to the amine functional group, which can affect its reactivity and interactions with other molecules. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as derivatives of pyridine are often explored for their biological activities. However, specific information regarding its toxicity, stability, and detailed reactivity would require further investigation through experimental studies and literature review.

Formula: C₉H₁₃ClN₂

InChI: InChI=1S/C9H13ClN2/c1-3-7(2)11-9-6-4-5-8(10)12-9/h4-7H,3H2,1-2H3,(H,11,12)

InChI key: InChIKey=CLYXFGBWTVTEKK-UHFFFAOYSA-N

SMILES: N(C(CC)C)C=1N=C(Cl)C=CC1

Synonyms:

• 2-Pyridinamine, 6-chloro-N-(1-methylpropyl)-
• 6-Chloro-N-(1-methylpropyl)-2-pyridinamine