CAS 1220029-89-9

Piperidine, 4-[2-(3-methyl-4-nitrophenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(3-methyl-4-nitrophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a substituent that includes a 3-methyl-4-nitrophenoxy group attached to a two-carbon ethyl linker. The presence of the nitro group indicates potential for reactivity and biological activity, often associated with compounds used in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and it may participate in various chemical reactions, including nucleophilic substitutions. Its specific applications and biological activities would depend on further studies, but compounds of this nature are often explored for their potential in drug development and as intermediates in organic synthesis. Safety and handling precautions should be observed due to the presence of the nitro group, which can be hazardous.

Formula: C₁₄H₂₀N₂O₃·ClH

InChI: InChI=1S/C14H20N2O3.ClH/c1-11-10-13(2-3-14(11)16(17)18)19-9-6-12-4-7-15-8-5-12;/h2-3,10,12,15H,4-9H2,1H3;1H

InChI key: InChIKey=OMEQQYRWWAIWOK-UHFFFAOYSA-N

SMILES: O(CCC1CCNCC1)C2=CC(C)=C(N(=O)=O)C=C2.Cl

Synonyms:

• Piperidine, 4-[2-(3-methyl-4-nitrophenoxy)ethyl]-, hydrochloride (1:1)