
CAS 1220029-94-6
:1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, 4,5,6,7-tetrahydro-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)
Description:
1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, 4,5,6,7-tetrahydro-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core and a tetrahydro-pyran moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The hydrochloride salt form indicates that it is a stable, water-soluble derivative, which is often advantageous for pharmaceutical applications. The presence of multiple functional groups suggests that it may participate in hydrogen bonding and other intermolecular interactions, influencing its solubility and reactivity. Additionally, the compound's molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 1220029-94-6, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in research and industry.
Formula:C13H20N4O2·ClH
InChI:InChI=1S/C13H20N4O2.ClH/c18-13(15-7-9-2-5-19-6-3-9)12-10-8-14-4-1-11(10)16-17-12;/h9,14H,1-8H2,(H,15,18)(H,16,17);1H
InChI key:InChIKey=WEYLZQWOYHUASO-UHFFFAOYSA-N
SMILES:C(NCC1CCOCC1)(=O)C=2C3=C(NN2)CCNC3.Cl
Synonyms:- 1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, 4,5,6,7-tetrahydro-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.