CAS 1220030-15-8

4-Piperidinemethanamine, N-butyl-N-methyl-, hydrochloride (1:2)

Description:

4-Piperidinemethanamine, N-butyl-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of both butyl and methyl groups on the nitrogen atom of the piperidine ring suggests that this compound may exhibit lipophilic properties, potentially influencing its pharmacokinetics and interaction with biological membranes. The compound's molecular structure indicates it may act as a ligand for certain receptors or enzymes, making it of interest in medicinal chemistry. Additionally, its hydrochloride form is often used to stabilize the compound and improve its handling and storage. Safety data should be consulted for handling precautions, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₁₁H₂₄N₂·2ClH

InChI: InChI=1S/C11H24N2.2ClH/c1-3-4-9-13(2)10-11-5-7-12-8-6-11;;/h11-12H,3-10H2,1-2H3;2*1H

InChI key: InChIKey=XOOBPISPKKWZEX-UHFFFAOYSA-N

SMILES: C(N(CCCC)C)C1CCNCC1.Cl

Synonyms:

• 4-Piperidinemethanamine, N-butyl-N-methyl-, hydrochloride (1:2)