
CAS 1220030-31-8
:Piperidine, 4-[2-(pentyloxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[2-(pentyloxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a pentyloxyethyl side chain, contributing to its unique properties and potential applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical and pharmaceutical contexts. The presence of the pentyloxy group may influence its lipophilicity and biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential interactions with biological systems, which could be explored for therapeutic applications. Additionally, its stability and reactivity can be influenced by the pH of the environment, as is common with many hydrochloride salts. Overall, this compound represents a specific class of piperidine derivatives that may exhibit interesting pharmacological properties, warranting further investigation in drug development and related fields.
Formula:C12H25NO·ClH
InChI:InChI=1S/C12H25NO.ClH/c1-2-3-4-10-14-11-7-12-5-8-13-9-6-12;/h12-13H,2-11H2,1H3;1H
InChI key:InChIKey=UPTTUUSTPJMNQK-UHFFFAOYSA-N
SMILES:C(COCCCCC)C1CCNCC1.Cl
Synonyms:- Piperidine, 4-[2-(pentyloxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.