
CAS 1220030-40-9
:3-Piperidineethanamine, N,N-diethyl-, hydrochloride (1:2)
Description:
3-Piperidineethanamine, N,N-diethyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and ethylamine functional groups. It is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in organic synthesis and pharmaceutical research. The compound features a piperidine ring, a six-membered saturated nitrogen-containing heterocycle, which contributes to its basicity and potential biological activity. The presence of diethyl groups indicates that it has two ethyl substituents on the nitrogen atom, which can influence its lipophilicity and interaction with biological systems. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit properties relevant to medicinal chemistry, including potential use as a building block in drug development or as a ligand in coordination chemistry. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C11H24N2·2ClH
InChI:InChI=1S/C11H24N2.2ClH/c1-3-13(4-2)9-7-11-6-5-8-12-10-11;;/h11-12H,3-10H2,1-2H3;2*1H
InChI key:InChIKey=JVIMVCSOEYEMBO-UHFFFAOYSA-N
SMILES:C(CN(CC)CC)C1CCCNC1.Cl
Synonyms:- 3-Piperidineethanamine, N,N-diethyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.