CAS 1220030-52-3
:5-Bromo-N-(2-methylphenyl)-2-pyridinamine
Description:
5-Bromo-N-(2-methylphenyl)-2-pyridinamine is an organic compound characterized by its bromine substitution and pyridine ring structure. It features a bromine atom attached to the fifth position of a pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The compound also has an amine functional group, specifically an aniline derivative, where a 2-methylphenyl group is attached to the nitrogen atom. This structure contributes to its potential biological activity and makes it of interest in medicinal chemistry. The presence of the bromine atom can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the methyl group on the phenyl ring can affect the compound's lipophilicity and solubility, which are important factors in drug design. Overall, 5-Bromo-N-(2-methylphenyl)-2-pyridinamine exhibits characteristics typical of halogenated aromatic amines, making it a subject of study for various applications, including pharmaceuticals and agrochemicals.
Formula:C12H11BrN2
InChI:InChI=1S/C12H11BrN2/c1-9-4-2-3-5-11(9)15-12-7-6-10(13)8-14-12/h2-8H,1H3,(H,14,15)
InChI key:InChIKey=HSFHQSLGKJLUTM-UHFFFAOYSA-N
SMILES:N(C1=C(C)C=CC=C1)C2=CC=C(Br)C=N2
Synonyms:- 2-Pyridinamine, 5-bromo-N-(2-methylphenyl)-
- 5-Bromo-N-(2-methylphenyl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.