CAS 1220030-55-6

Piperidine, 3-[2-bromo-4-(1-methyl-1-phenylethyl)phenoxy]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-bromo-4-(1-methyl-1-phenylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a brominated phenyl group and a phenoxy moiety, contributing to its potential biological activity. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in water and may influence its pharmacokinetic properties. The compound is likely to exhibit properties typical of piperidine derivatives, such as being a potential ligand for various receptors or enzymes, making it of interest in medicinal chemistry. Its structure suggests possible applications in drug development, particularly in areas targeting the central nervous system or other therapeutic areas. As with many chemical substances, safety data and handling precautions are essential, given the presence of bromine, which can be hazardous. Further research would be necessary to elucidate its specific biological activities and potential applications.

Formula: C₂₀H₂₄BrNO·ClH

InChI: InChI=1S/C20H24BrNO.ClH/c1-20(2,15-7-4-3-5-8-15)16-10-11-19(18(21)13-16)23-17-9-6-12-22-14-17;/h3-5,7-8,10-11,13,17,22H,6,9,12,14H2,1-2H3;1H

InChI key: InChIKey=IXLDBPMEVOEOLU-UHFFFAOYSA-N

SMILES: C(C)(C)(C1=CC(Br)=C(OC2CCCNC2)C=C1)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 3-[2-bromo-4-(1-methyl-1-phenylethyl)phenoxy]-, hydrochloride (1:1)