CymitQuimica logo

CAS 1220030-59-0

:

1-(5-Bromo-3-methyl-2-pyridinyl)-4-(phenylmethyl)piperazine

Description:
1-(5-Bromo-3-methyl-2-pyridinyl)-4-(phenylmethyl)piperazine is a chemical compound characterized by its complex structure, which includes a piperazine ring substituted with a phenylmethyl group and a pyridine moiety that contains a bromine atom and a methyl group. This compound is typically classified as a piperazine derivative, which often exhibits pharmacological properties, making it of interest in medicinal chemistry. The presence of the bromine atom can influence the compound's reactivity and biological activity, while the methyl group on the pyridine ring may affect its lipophilicity and solubility. The phenylmethyl substituent can enhance interactions with biological targets, potentially influencing its efficacy as a drug candidate. Overall, the unique combination of functional groups in this compound suggests potential applications in therapeutic areas, although specific biological activities would require further investigation through experimental studies.
Formula:C17H20BrN3
InChI:InChI=1S/C17H20BrN3/c1-14-11-16(18)12-19-17(14)21-9-7-20(8-10-21)13-15-5-3-2-4-6-15/h2-6,11-12H,7-10,13H2,1H3
InChI key:InChIKey=FBUUQLORYBONSB-UHFFFAOYSA-N
SMILES:CC1=C(N2CCN(CC3=CC=CC=C3)CC2)N=CC(Br)=C1
Synonyms:
  • Piperazine, 1-(5-bromo-3-methyl-2-pyridinyl)-4-(phenylmethyl)-
  • 1-(5-Bromo-3-methyl-2-pyridinyl)-4-(phenylmethyl)piperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.