CAS 1220030-68-1

1-(1-Methylethyl)-3-pyrrolidineacetic acid

Description:

1-(1-Methylethyl)-3-pyrrolidineacetic acid, identified by its CAS number 1220030-68-1, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of an isopropyl group (1-methylethyl) attached to the pyrrolidine ring, along with an acetic acid functional group. The structure suggests that it may exhibit properties typical of both amines and carboxylic acids, potentially allowing for interactions such as hydrogen bonding. The presence of the pyrrolidine moiety may impart certain biological activities, making it of interest in pharmaceutical research. Additionally, the compound's solubility and reactivity can be influenced by the functional groups present, which may affect its behavior in various chemical environments. Overall, while specific physical and chemical properties such as melting point, boiling point, and solubility are not provided, the structural features indicate potential applications in medicinal chemistry and organic synthesis.

Formula: C₉H₁₇NO₂

InChI: InChI=1S/C9H17NO2/c1-7(2)10-4-3-8(6-10)5-9(11)12/h7-8H,3-6H2,1-2H3,(H,11,12)

InChI key: InChIKey=NOJHRCAUUATHBK-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1CN(C(C)C)CC1

Synonyms:

• 3-Pyrrolidineacetic acid, 1-(1-methylethyl)-
• 1-(1-Methylethyl)-3-pyrrolidineacetic acid