CAS 1220030-69-2
:5-Bromo-N-butyl-N-methyl-2-pyridinamine
Description:
5-Bromo-N-butyl-N-methyl-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position of the pyridine ring introduces a halogen substituent, which can influence the compound's reactivity and solubility. The N-butyl and N-methyl groups attached to the nitrogen atom contribute to the compound's overall hydrophobic character, potentially affecting its interaction with biological systems and solvents. This compound may exhibit properties such as moderate to high lipophilicity, making it suitable for various applications in medicinal chemistry and agrochemicals. Additionally, the presence of the amine functional group suggests potential for hydrogen bonding, which could influence its solubility in polar solvents. Overall, 5-Bromo-N-butyl-N-methyl-2-pyridinamine is a versatile compound with potential applications in drug development and chemical synthesis, although specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C10H15BrN2
InChI:InChI=1S/C10H15BrN2/c1-3-4-7-13(2)10-6-5-9(11)8-12-10/h5-6,8H,3-4,7H2,1-2H3
InChI key:InChIKey=VSVLJQIJTPNONS-UHFFFAOYSA-N
SMILES:N(CCCC)(C)C1=CC=C(Br)C=N1
Synonyms:- 2-Pyridinamine, 5-bromo-N-butyl-N-methyl-
- 5-Bromo-N-butyl-N-methyl-2-pyridinamine
- 5-BROMO-N-BUTYL-N-METHYLPYRIDIN-2-AMINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.