
CAS 1220030-82-9
:Piperidine, 4-[2-chloro-4-(1-methylethyl)phenoxy]-, hydrochloride (1:1)
Description:
Piperidine, 4-[2-chloro-4-(1-methylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a phenoxy group substituted with a chloro and isopropyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the chloro and isopropyl substituents can influence its biological activity and interaction with receptors or enzymes. This compound may exhibit potential pharmacological effects, making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and safety profiles would require further investigation through empirical studies. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C14H20ClNO·ClH
InChI:InChI=1S/C14H20ClNO.ClH/c1-10(2)11-3-4-14(13(15)9-11)17-12-5-7-16-8-6-12;/h3-4,9-10,12,16H,5-8H2,1-2H3;1H
InChI key:InChIKey=AWWABBPAXRRZOM-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=C(C(C)C)C=C1)C2CCNCC2.Cl
Synonyms:- Piperidine, 4-[2-chloro-4-(1-methylethyl)phenoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.