
CAS 1220030-89-6
:1-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-3-pyrrolidinol
Description:
1-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-3-pyrrolidinol, identified by its CAS number 1220030-89-6, is a chemical compound characterized by its unique structural features, which include a triazine ring and a pyrrolidinyl group. The presence of the amino and chloro substituents on the triazine ring contributes to its potential reactivity and biological activity. This compound is likely to exhibit properties typical of both heterocyclic compounds and amines, such as solubility in polar solvents and the ability to participate in hydrogen bonding. Its triazine moiety may impart herbicidal or antimicrobial properties, making it of interest in agricultural and pharmaceutical applications. The pyrrolidinol portion suggests potential for further functionalization, which could enhance its utility in various chemical reactions. Overall, this compound's characteristics make it a subject of interest for research in medicinal chemistry and agrochemicals, although specific applications and biological activities would require further investigation.
Formula:C7H10ClN5O
InChI:InChI=1S/C7H10ClN5O/c8-5-10-6(9)12-7(11-5)13-2-1-4(14)3-13/h4,14H,1-3H2,(H2,9,10,11,12)
InChI key:InChIKey=IOVZPVMGQUUNNC-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC(N)=N1)N2CCC(O)C2
Synonyms:- 1-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-3-pyrrolidinol
- 3-Pyrrolidinol, 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.