CAS 1220030-90-9

5-Bromo-N-ethyl-N-(phenylmethyl)-2-pyridinamine

Description:

5-Bromo-N-ethyl-N-(phenylmethyl)-2-pyridinamine is an organic compound characterized by its bromine substitution on the pyridine ring and the presence of an ethyl and a phenylmethyl group attached to the nitrogen atoms. This compound features a pyridine moiety, which contributes to its aromatic properties and potential biological activity. The bromine atom enhances its reactivity, making it a useful intermediate in various synthetic applications, including medicinal chemistry. The presence of the ethyl and phenylmethyl groups can influence its solubility, lipophilicity, and interaction with biological targets. Typically, compounds like this may exhibit properties such as moderate to high melting points and specific solubility characteristics in organic solvents. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties due to the delocalization of electrons within the aromatic system. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.

Formula: C₁₄H₁₅BrN₂

InChI: InChI=1S/C14H15BrN2/c1-2-17(11-12-6-4-3-5-7-12)14-9-8-13(15)10-16-14/h3-10H,2,11H2,1H3

InChI key: InChIKey=DEWZPKYMXDGZTB-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)(CC)C2=CC=C(Br)C=N2

Synonyms:

• 2-Pyridinamine, 5-bromo-N-ethyl-N-(phenylmethyl)-
• 5-Bromo-N-ethyl-N-(phenylmethyl)-2-pyridinamine