
CAS 1220030-91-0
:Piperidine, 4-[2-chloro-4-(1-methylpropyl)phenoxy]-, hydrochloride (1:1)
Description:
Piperidine, 4-[2-chloro-4-(1-methylpropyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a chloro-substituted phenoxy group, which contributes to its potential biological activity. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The molecular structure suggests that it may exhibit properties relevant to medicinal chemistry, potentially acting as a ligand or modulator in biological systems. Its specific interactions and effects would depend on the functional groups and their spatial arrangement, which can influence pharmacokinetics and pharmacodynamics. As with many piperidine derivatives, it may be of interest in the development of therapeutic agents, but detailed studies would be necessary to elucidate its full profile, including toxicity, efficacy, and mechanism of action.
Formula:C15H22ClNO·ClH
InChI:InChI=1S/C15H22ClNO.ClH/c1-3-11(2)12-4-5-15(14(16)10-12)18-13-6-8-17-9-7-13;/h4-5,10-11,13,17H,3,6-9H2,1-2H3;1H
InChI key:InChIKey=BCIXIZROVNKQCI-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=C(C(CC)C)C=C1)C2CCNCC2.Cl
Synonyms:- Piperidine, 4-[2-chloro-4-(1-methylpropyl)phenoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.