CAS 1220030-95-4

Pyrrolidine, 3-[[4-chloro-2-(1-methylpropyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[[4-chloro-2-(1-methylpropyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a chloro-substituted phenoxy group contributes to its unique properties, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, although specific activity would depend on further empirical studies. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific class of organic molecules that may have applications in drug development or other chemical research fields.

Formula: C₁₅H₂₂ClNO·ClH

InChI: InChI=1S/C15H22ClNO.ClH/c1-3-11(2)14-8-13(16)4-5-15(14)18-10-12-6-7-17-9-12;/h4-5,8,11-12,17H,3,6-7,9-10H2,1-2H3;1H

InChI key: InChIKey=GEYUBZZSDONKQG-UHFFFAOYSA-N

SMILES: C(CC)(C)C1=C(OCC2CCNC2)C=CC(Cl)=C1.Cl

Synonyms:

• Pyrrolidine, 3-[[4-chloro-2-(1-methylpropyl)phenoxy]methyl]-, hydrochloride (1:1)