CymitQuimica logo

CAS 1220030-99-8

:

Pyrrolidine, 3-[[(5-chloro[1,1′-biphenyl]-2-yl)oxy]methyl]-, hydrochloride (1:1)

Description:
Pyrrolidine, 3-[[(5-chloro[1,1′-biphenyl]-2-yl)oxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a chloro-substituted biphenyl moiety indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The hydrochloride salt form suggests enhanced solubility in aqueous environments, making it suitable for biological studies or formulations. This compound may exhibit specific pharmacological properties due to its structural features, including potential interactions with biological targets. Its molecular structure likely contributes to its stability and reactivity, influencing its behavior in various chemical environments. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of chlorine, which can impart toxicity. Overall, this compound represents a unique combination of a cyclic amine and a biphenyl derivative, warranting further investigation for its potential applications in drug development and other chemical processes.
Formula:C17H18ClNO·ClH
InChI:InChI=1S/C17H18ClNO.ClH/c18-15-6-7-17(20-12-13-8-9-19-11-13)16(10-15)14-4-2-1-3-5-14;/h1-7,10,13,19H,8-9,11-12H2;1H
InChI key:InChIKey=PQJJLSWOCIWOFR-UHFFFAOYSA-N
SMILES:O(CC1CCNC1)C2=C(C=C(Cl)C=C2)C3=CC=CC=C3.Cl
Synonyms:
  • Pyrrolidine, 3-[[(5-chloro[1,1′-biphenyl]-2-yl)oxy]methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.