CAS 1220031-01-5
:2-[(4-Amino-6-chloro-1,3,5-triazin-2-yl)methylamino]ethanol
Description:
2-[(4-Amino-6-chloro-1,3,5-triazin-2-yl)methylamino]ethanol is a chemical compound characterized by its triazine core, which features a chlorine atom and an amino group that contribute to its reactivity and potential biological activity. The presence of the ethanol moiety suggests that it has hydroxyl functional groups, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit properties typical of triazine derivatives, such as herbicidal or antimicrobial activity, due to the triazine ring's ability to interact with biological targets. The amino group can also facilitate interactions with various biomolecules, making it of interest in pharmaceutical applications. Additionally, the compound's structure indicates potential for modification, allowing for the development of derivatives with tailored properties. Overall, its unique combination of functional groups and structural features positions it as a compound of interest in both agricultural and medicinal chemistry.
Formula:C6H10ClN5O
InChI:InChI=1S/C6H10ClN5O/c1-12(2-3-13)6-10-4(7)9-5(8)11-6/h13H,2-3H2,1H3,(H2,8,9,10,11)
InChI key:InChIKey=MSOODBXJEJLCBR-UHFFFAOYSA-N
SMILES:N(CCO)(C)C=1N=C(Cl)N=C(N)N1
Synonyms:- Ethanol, 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)methylamino]-
- 2-[(4-Amino-6-chloro-1,3,5-triazin-2-yl)methylamino]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.