CAS 1220031-03-7

Piperidine, 3-[2-[2-methoxy-4-(2-propen-1-yl)phenoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-[2-methoxy-4-(2-propen-1-yl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxy group substituted with a methoxy group and an allyl group, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the methoxy and allyl substituents may influence its pharmacokinetic properties, such as absorption and metabolism. The compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, including its stability, solubility, and biological effects.

Formula: C₁₇H₂₅NO₂·ClH

InChI: InChI=1S/C17H25NO2.ClH/c1-3-5-14-7-8-16(17(12-14)19-2)20-11-9-15-6-4-10-18-13-15;/h3,7-8,12,15,18H,1,4-6,9-11,13H2,2H3;1H

InChI key: InChIKey=PUMQHMKOFVSBRA-UHFFFAOYSA-N

SMILES: O(CCC1CCCNC1)C2=C(OC)C=C(CC=C)C=C2.Cl

Synonyms:

• Piperidine, 3-[2-[2-methoxy-4-(2-propen-1-yl)phenoxy]ethyl]-, hydrochloride (1:1)