CAS 1220031-28-6

Propanamide, 3-amino-N-methyl-N-(phenylmethyl)-, hydrochloride (1:1)

Description:

Propanamide, 3-amino-N-methyl-N-(phenylmethyl)-, hydrochloride (1:1), with the CAS number 1220031-28-6, is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. This substance features a methyl group and a phenylmethyl (benzyl) group attached to the nitrogen atom, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the amino group suggests potential basicity, while the aromatic phenylmethyl moiety may impart specific interactions in biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a class of amides that may have significant implications in drug development and chemical research.

Formula: C₁₁H₁₆N₂O·ClH

InChI: InChI=1S/C11H16N2O.ClH/c1-13(11(14)7-8-12)9-10-5-3-2-4-6-10;/h2-6H,7-9,12H2,1H3;1H

InChI key: InChIKey=VDDSXWPSAQPRPC-UHFFFAOYSA-N

SMILES: C(N(C(CCN)=O)C)C1=CC=CC=C1.Cl

Synonyms:

• Propanamide, 3-amino-N-methyl-N-(phenylmethyl)-, hydrochloride (1:1)

3-Amino-N-benzyl-N-methylpropanamide hydrochloride

CAS: 1220031-28-6

Versatile small molecule scaffold

Formula: C₁₁H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 228.72 g/mol

Ref: 3D-VYB03128