CAS 1220031-29-7

Piperidine, 3-[2-([1,1′-biphenyl]-4-ylmethoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-([1,1′-biphenyl]-4-ylmethoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a biphenyl moiety, indicating the presence of two phenyl rings connected by a single bond, which contributes to its hydrophobic characteristics. The methoxyethyl substituent enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and organic synthesis. The presence of the hydrochloride group also suggests that it may exhibit basic properties, allowing it to interact with various biological systems. This compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders, given the known pharmacological properties of piperidine derivatives. However, specific biological activity and safety profiles would require further investigation through empirical studies.

Formula: C₂₀H₂₆ClNO

InChI: InChI=1S/C20H25NO.ClH/c1-2-6-19(7-3-1)20-10-8-18(9-11-20)16-22-14-12-17-5-4-13-21-15-17;/h1-3,6-11,17,21H,4-5,12-16H2;1H

InChI key: InChIKey=GSTPMWBEALZRGM-UHFFFAOYSA-N

SMILES: C(OCCC1CCCNC1)C2=CC=C(C=C2)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 3-[2-([1,1′-biphenyl]-4-ylmethoxy)ethyl]-, hydrochloride (1:1)
• 3-[2-([1,1'-Biphenyl]-4-ylmethoxy)ethyl]-piperidine hydrochloride