CAS 1220031-31-1

4-Pyridinecarboxylic acid, 4-piperidinylmethyl ester, hydrochloride (1:1)

Description:

4-Pyridinecarboxylic acid, 4-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the carboxylic acid group suggests that it may exhibit acidic properties, while the piperidine ring can impart structural rigidity and influence the compound's interaction with biological targets. This compound may be used in medicinal chemistry for the development of drugs, particularly those targeting neurological or psychiatric conditions, due to the presence of the piperidine structure, which is common in many psychoactive substances. Additionally, its molecular structure may allow for various functionalizations, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, particularly when dealing with hydrochloride salts.

Formula: C₁₂H₁₆N₂O₂·ClH

InChI: InChI=1S/C12H16N2O2.ClH/c15-12(11-3-7-14-8-4-11)16-9-10-1-5-13-6-2-10;/h3-4,7-8,10,13H,1-2,5-6,9H2;1H

InChI key: InChIKey=APXFKDSFESBFQE-UHFFFAOYSA-N

SMILES: C(OCC1CCNCC1)(=O)C=2C=CN=CC2.Cl

Synonyms:

• 4-Pyridinecarboxylic acid, 4-piperidinylmethyl ester, hydrochloride (1:1)