
CAS 1220031-35-5
:2-Pyridinecarboxylic acid, 4-chloro-, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1)
Description:
2-Pyridinecarboxylic acid, 4-chloro-, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1), with CAS number 1220031-35-5, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The presence of the chloro substituent on the pyridine ring can influence its reactivity and biological activity, making it of interest in medicinal chemistry. The ester functional group suggests potential for hydrolysis under certain conditions, which may release the corresponding acid and alcohol. This compound may exhibit various pharmacological properties, potentially acting as a ligand for specific receptors or enzymes, although detailed biological activity would require further investigation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C13H17ClN2O2·ClH
InChI:InChI=1S/C13H17ClN2O2.ClH/c14-11-3-6-16-12(8-11)13(17)18-7-4-10-2-1-5-15-9-10;/h3,6,8,10,15H,1-2,4-5,7,9H2;1H
InChI key:InChIKey=LQBOLCVZGGZMAC-UHFFFAOYSA-N
SMILES:C(OCCC1CCCNC1)(=O)C2=CC(Cl)=CC=N2.Cl
Synonyms:- 2-Pyridinecarboxylic acid, 4-chloro-, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.