
CAS 1220031-36-6
:Pyrrolidine, 3-[(3-methoxypropoxy)methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[(3-methoxypropoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 3-methoxypropoxy group indicates that it has an ether functional group, contributing to its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and research. The compound may exhibit biological activity due to its amine structure, which can interact with biological systems, potentially influencing neurotransmitter pathways or other physiological processes. Its molecular structure suggests it may be used in the synthesis of more complex molecules or as a building block in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those that may have pharmacological effects.
Formula:C9H19NO2·ClH
InChI:InChI=1S/C9H19NO2.ClH/c1-11-5-2-6-12-8-9-3-4-10-7-9;/h9-10H,2-8H2,1H3;1H
InChI key:InChIKey=UXPXOYHGDFGRFB-UHFFFAOYSA-N
SMILES:C(OCCCOC)C1CCNC1.Cl
Synonyms:- Pyrrolidine, 3-[(3-methoxypropoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.